ethyl 3-(4-nitrophenyl)but-2-enoate structure
|
Common Name | ethyl 3-(4-nitrophenyl)but-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 80854-57-5 | Molecular Weight | 235.23600 | |
| Density | 1.184g/cm3 | Boiling Point | 329.5ºC at 760 mmHg | |
| Molecular Formula | C12H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.7ºC | |
| Name | ethyl (E)-3-(4-nitrophenyl)but-2-enoate |
|---|
| Density | 1.184g/cm3 |
|---|---|
| Boiling Point | 329.5ºC at 760 mmHg |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.23600 |
| Flash Point | 134.7ºC |
| Exact Mass | 235.08400 |
| PSA | 72.12000 |
| LogP | 3.08440 |
| Index of Refraction | 1.547 |
| InChIKey | GXKAVJLXZLKIAJ-CMDGGOBGSA-N |
| SMILES | CCOC(=O)C=C(C)c1ccc([N+](=O)[O-])cc1 |
|
~67%
ethyl 3-(4-nitr... CAS#:80854-57-5 |
| Literature: Pedro, Filipe M.; Hirner, Sebastian; Kuehn, Fritz E. Tetrahedron Letters, 2005 , vol. 46, # 45 p. 7777 - 7779 |
|
~%
ethyl 3-(4-nitr... CAS#:80854-57-5 |
| Literature: Schroeter; Wuelfing Chemische Berichte, 1907 , vol. 40, p. 1594 |
|
~%
ethyl 3-(4-nitr... CAS#:80854-57-5 |
| Literature: Baker,B.R.; Lourens,G.J. Journal of Medicinal Chemistry, 1968 , vol. 11, # 4 p. 672 - 676 |