Benzenebutanoicacid,-[[(1S)-1-carboxyethyl]amino]-,monoethylester,hydrochloride,(S)-(9CI) structure
|
Common Name | Benzenebutanoicacid,-[[(1S)-1-carboxyethyl]amino]-,monoethylester,hydrochloride,(S)-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 80828-26-8 | Molecular Weight | 279.33200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H21NO4 |
|---|---|
| Molecular Weight | 279.33200 |
| Exact Mass | 279.14700 |
| PSA | 75.63000 |
| LogP | 2.00450 |
| InChIKey | CEIWXEQZZZHLDM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CCc1ccccc1)NC(C)C(=O)O |
|
~%
Benzenebutanoic... CAS#:80828-26-8 |
| Literature: LUPIN LIMITED Patent: WO2004/54980 A1, 2004 ; Location in patent: Page 22-23;13;16 ; |
|
~92%
Benzenebutanoic... CAS#:80828-26-8 |
| Literature: Miyake; Itoh; Oka Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 7 p. 2852 - 2858 |
|
~%
Benzenebutanoic... CAS#:80828-26-8 |
| Literature: Miyake; Itoh; Oka Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 7 p. 2852 - 2858 |
| Precursor 3 | |
|---|---|
| DownStream 7 | |
| N-[(S)-1-carbethoxy-3-phenyl-propyl]-S-alanine hydrochloride |
| N-((S)-1-ethoxycarbonyl-3-phenylpropyl)-L-alanine |
| (S)-2-((S)-1-ethoxy-1-oxo-4-phenylbutan-2-ylamino)propanoic acid |
| (S)-N-(1-ETHOXYCARBONYL-3-PHENYLPROPYL)-(S)-ALANINE |