8,9-dehydrotheaspirone
Modify Date: 2025-08-25 18:42:50
8,9-dehydrotheaspirone structure
|
Common Name | 8,9-dehydrotheaspirone | ||
|---|---|---|---|---|
| CAS Number | 80722-28-7 | Molecular Weight | 206.28100 | |
| Density | 1.05g/cm3 | Boiling Point | 319.3ºC at 760 mmHg | |
| Molecular Formula | C13H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.8ºC | |
| Name | 2,6,6,10-tetramethyl-1-oxaspiro[4.5]deca-2,9-dien-8-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 319.3ºC at 760 mmHg |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28100 |
| Flash Point | 136.8ºC |
| Exact Mass | 206.13100 |
| PSA | 26.30000 |
| LogP | 2.99460 |
| Index of Refraction | 1.517 |
| InChIKey | PYBOFDINXIGETR-UHFFFAOYSA-N |
| SMILES | CC1=CCC2(O1)C(C)=CC(=O)CC2(C)C |
|
~%
8,9-dehydrothea... CAS#:80722-28-7 |
| Literature: Shibagaki, Makoto; Shibata, Saizo; Kaneko, Hajime Agricultural and Biological Chemistry, 1981 , vol. 45, # l2 p. 2911 - 2914 |
|
~%
8,9-dehydrothea... CAS#:80722-28-7 |
| Literature: Shibagaki, Makoto; Shibata, Saizo; Kaneko, Hajime Agricultural and Biological Chemistry, 1981 , vol. 45, # l2 p. 2911 - 2914 |
|
~%
8,9-dehydrothea... CAS#:80722-28-7 |
| Literature: Shibagaki, Makoto; Shibata, Saizo; Kaneko, Hajime Agricultural and Biological Chemistry, 1981 , vol. 45, # l2 p. 2911 - 2914 |
![7,9,9-trimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-one structure](https://image.chemsrc.com/caspic/122/14203-64-6.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-Oxaspiro[4.5]deca-2,6-dien-8-one,2,6,10,10-tetramethyl |
| 8,9-dehydrotheaspirone |
| EINECS 279-534-3 |
| 2,6,10,10-Tetramethyl-1-oxaspiro(4.5)deca-2,6-dien-8-one |
| UNII-6AQT87PG7Q |