7-chloro-6-(N-methylanilino)-2-phenylpyrano[3,2-g][1,3]benzothiazol-8-one
Modify Date: 2025-08-26 12:24:46
![7-chloro-6-(N-methylanilino)-2-phenylpyrano[3,2-g][1,3]benzothiazol-8-one Structure](https://image.chemsrc.com/caspic/196/80616-38-2.png)
7-chloro-6-(N-methylanilino)-2-phenylpyrano[3,2-g][1,3]benzothiazol-8-one structure
|
Common Name | 7-chloro-6-(N-methylanilino)-2-phenylpyrano[3,2-g][1,3]benzothiazol-8-one | ||
|---|---|---|---|---|
| CAS Number | 80616-38-2 | Molecular Weight | 418.89500 | |
| Density | 1.46g/cm3 | Boiling Point | 595.7ºC at 760 mmHg | |
| Molecular Formula | C23H15ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314.1ºC | |
| Name | 7-chloro-6-(N-methylanilino)-2-phenylpyrano[3,2-g][1,3]benzothiazol-8-one |
|---|
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 595.7ºC at 760 mmHg |
| Molecular Formula | C23H15ClN2O2S |
| Molecular Weight | 418.89500 |
| Flash Point | 314.1ºC |
| Exact Mass | 418.05400 |
| PSA | 74.58000 |
| LogP | 6.49100 |
| Index of Refraction | 1.748 |
| InChIKey | DSUZRHYZODTCET-UHFFFAOYSA-N |
| SMILES | CN(c1ccccc1)c1c(Cl)c(=O)oc2c1ccc1nc(-c3ccccc3)sc12 |
|
~52%
7-chloro-6-(N-m... CAS#:80616-38-2 |
| Literature: Mosti, Luisa; Menozzi, Giulia; Schenone, Pietro Journal of Heterocyclic Chemistry, 1981 , vol. 18, p. 1263 - 1267 |
|
~%
7-chloro-6-(N-m... CAS#:80616-38-2 |
| Literature: Mosti, Luisa; Menozzi, Giulia; Schenone, Pietro Journal of Heterocyclic Chemistry, 1981 , vol. 18, p. 1263 - 1267 |
![7-chloro-6-(methyl(phenyl)amino)-2-phenyl-4,5-dihydro-8H-chromeno[7,8-d]thiazol-8-one structure](https://image.chemsrc.com/caspic/358/80616-34-8.png)
![7,7-dichloro-6-(N-methylanilino)-2-phenyl-5,6-dihydro-4H-pyrano[3,2-g][1,3]benzothiazol-8-one structure](https://image.chemsrc.com/caspic/211/80633-40-5.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |