Trityl-L-Alanine Diethylammonium Salt structure
|
Common Name | Trityl-L-Alanine Diethylammonium Salt | ||
|---|---|---|---|---|
| CAS Number | 80514-65-4 | Molecular Weight | 404.544 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H32N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Diethylamine (S)-2-(tritylamino)propanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H32N2O2 |
|---|---|
| Molecular Weight | 404.544 |
| Exact Mass | 404.246368 |
| PSA | 61.36000 |
| LogP | 5.43880 |
| Appearance of Characters | Solid |
| InChIKey | PWGPLCPGMCXDCL-LMOVPXPDSA-N |
| SMILES | CC(NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O.CCNCC |
| HS Code | 2922499990 |
|---|
|
~%
Trityl-L-Alanin... CAS#:80514-65-4 |
| Literature: Mamos, Petros; Sanida, Chariklia; Barlos, Kleomenis Liebigs Annalen der Chemie, 1988 , p. 1083 - 1084 |
|
~%
Trityl-L-Alanin... CAS#:80514-65-4 |
| Literature: Mamos, Petros; Sanida, Chariklia; Barlos, Kleomenis Liebigs Annalen der Chemie, 1988 , p. 1083 - 1084 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| N-ethylethanamine,(2S)-2-(tritylamino)propanoic acid |
| Alanine, N-(triphenylmethyl)-, compd. with N-ethylethanamine (1:1) |
| N-Tritylalanine - N-ethylethanamine (1:1) |
| Trityl-L-Alanine Diethylammonium Salt |