Benzophenone, 5-amino-2-methyl- (8CI) structure
|
Common Name | Benzophenone, 5-amino-2-methyl- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 802593-83-5 | Molecular Weight | 211.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5-Amino-2-methylphenyl)(phenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H13NO |
|---|---|
| Molecular Weight | 211.25900 |
| Exact Mass | 211.10000 |
| PSA | 43.09000 |
| LogP | 3.38940 |
| InChIKey | RQADOEBDTNZYLE-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N)cc1C(=O)c1ccccc1 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 5-Amino-2-methyl-benzonitril |
| 3-cyano-4-methyl-1-aminobenzene |
| 3-Cyano-4-methylaniline |
| 4-Amino-2-cyanotoluene |
| 2-cyano-3-methylaniline |
| 5-Amino-2-methylbenzenecarbonitrile |
| 5-Amino-2-methyl-benzophenon |
| 3-Amino-6-methylbenzonitrile |
| 5-amino-2-methyl-benzonitrile |
| 5-amino-2-methyl-benzophenone |