4-[4-(2-Methyl-2-propanyl)-1-piperazinyl]aniline
Modify Date: 2025-12-01 05:22:27
![4-[4-(2-Methyl-2-propanyl)-1-piperazinyl]aniline Structure](https://image.chemsrc.com/caspic/427/802541-78-2.png)
4-[4-(2-Methyl-2-propanyl)-1-piperazinyl]aniline structure
|
Common Name | 4-[4-(2-Methyl-2-propanyl)-1-piperazinyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 802541-78-2 | Molecular Weight | 233.352 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 376.7±37.0 °C at 760 mmHg | |
| Molecular Formula | C14H23N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.9±21.3 °C | |
| Name | 4-(4-tert-butylpiperazin-1-yl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 376.7±37.0 °C at 760 mmHg |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.352 |
| Flash Point | 178.9±21.3 °C |
| Exact Mass | 233.189194 |
| PSA | 32.50000 |
| LogP | 1.75 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | KHEUKJILBHLJGP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1CCN(c2ccc(N)cc2)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-[4-(2-Methyl-2-propanyl)-1-piperazinyl]aniline |
| y6409 |
| Benzenamine, 4-[4-(1,1-dimethylethyl)-1-piperazinyl]- |