Benzaldehyde,4-[bis(2-chloroethyl)amino]-, 2-(2-benzothiazolyl)hydrazone structure
|
Common Name | Benzaldehyde,4-[bis(2-chloroethyl)amino]-, 2-(2-benzothiazolyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 802-58-4 | Molecular Weight | 393.33300 | |
| Density | 1.33g/cm3 | Boiling Point | 557.1ºC at 760mmHg | |
| Molecular Formula | C18H18Cl2N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.7ºC | |
| Name | N-[(E)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-1,3-benzothiazol-2-amine |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 557.1ºC at 760mmHg |
| Molecular Formula | C18H18Cl2N4S |
| Molecular Weight | 393.33300 |
| Flash Point | 290.7ºC |
| Exact Mass | 392.06300 |
| PSA | 71.99000 |
| LogP | 4.44820 |
| Index of Refraction | 1.653 |
| InChIKey | XJMFQDQSJWOMAB-BKUYFWCQSA-N |
| SMILES | ClCCN(CCCl)c1ccc(C=NNc2nc3ccccc3s2)cc1 |
|
~%
Benzaldehyde,4-... CAS#:802-58-4 |
| Literature: Popp,F.D. Journal of Medicinal and Pharmaceutical Chemistry, 1962 , vol. 5, p. 627 - 629 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |