N-(guanin-8-yl)-1-naphthylamine structure
|
Common Name | N-(guanin-8-yl)-1-naphthylamine | ||
|---|---|---|---|---|
| CAS Number | 80156-61-2 | Molecular Weight | 292.29500 | |
| Density | 1.64g/cm3 | Boiling Point | 650.8ºC at 760 mmHg | |
| Molecular Formula | C15H12N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 347.4ºC | |
| Name | 2-amino-8-(naphthalen-1-ylamino)-3,7-dihydropurin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Boiling Point | 650.8ºC at 760 mmHg |
| Molecular Formula | C15H12N6O |
| Molecular Weight | 292.29500 |
| Flash Point | 347.4ºC |
| Exact Mass | 292.10700 |
| PSA | 116.70000 |
| LogP | 1.88950 |
| Index of Refraction | 1.852 |
| InChIKey | ZOBGLYSFKBBBCX-UHFFFAOYSA-N |
| SMILES | Nc1nc2nc(Nc3cccc4ccccc34)[nH]c2c(=O)[nH]1 |
|
~41%
N-(guanin-8-yl)... CAS#:80156-61-2 |
| Literature: Murofushi; Hashimoto; Shudo; Okamoto Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 9 p. 2730 - 2732 |
|
~%
N-(guanin-8-yl)... CAS#:80156-61-2 |
| Literature: Murofushi; Hashimoto; Shudo; Okamoto Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 9 p. 2730 - 2732 |
| G-8-1-NA |
| N-(guanin-C8-yl)-1-naphthylamine |
| 6H-Purin-6-one,2-amino-1,7-dihydro-8-(1-naphthalenylamino) |
| N-(GUANIN-8-YL)-NAPHTHALEN-1-YLAMINE |
| N-(Guanin-8-yl)-1-naphthylamine |
| 6H-Purin-6-one,2-amino-1,9-dihydro-8-(1-naphthalenylamino) |