Dextrose and sodium chloride
Modify Date: 2025-10-20 12:04:58
Dextrose and sodium chloride structure
|
Common Name | Dextrose and sodium chloride | ||
|---|---|---|---|---|
| CAS Number | 8012-23-5 | Molecular Weight | 238.60 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H12ClNaO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Dextrose and sodium chloride |
|---|
| Molecular Formula | C6H12ClNaO6 |
|---|---|
| Molecular Weight | 238.60 |
OCC1OC(O)C(O)C(O)C1O.[Cl-].[Na+]