5-amino-1-(2,3,4-trichlorophenyl)-1H-pyrazole-4-carbonitrile
Modify Date: 2024-10-05 13:03:59
5-amino-1-(2,3,4-trichlorophenyl)-1H-pyrazole-4-carbonitrile structure
|
Common Name | 5-amino-1-(2,3,4-trichlorophenyl)-1H-pyrazole-4-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 80025-46-3 | Molecular Weight | 287.53300 | |
| Density | 1.65g/cm3 | Boiling Point | 490.4ºC at 760 mmHg | |
| Molecular Formula | C10H5Cl3N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.4ºC | |
| Name | 5-amino-1-(2,3,4-trichlorophenyl)pyrazole-4-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.65g/cm3 |
|---|---|
| Boiling Point | 490.4ºC at 760 mmHg |
| Molecular Formula | C10H5Cl3N4 |
| Molecular Weight | 287.53300 |
| Flash Point | 250.4ºC |
| Exact Mass | 285.95800 |
| PSA | 67.63000 |
| LogP | 3.86758 |
| Index of Refraction | 1.714 |
| InChIKey | DBFMKRVPJIOMHQ-UHFFFAOYSA-N |
| SMILES | N#Cc1cnn(-c2ccc(Cl)c(Cl)c2Cl)c1N |
|
~64%
5-amino-1-(2,3,... CAS#:80025-46-3 |
| Literature: Eli Lilly and Company Patent: US4563210 A1, 1986 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-amino-4-cyano-1-(2,3,4-trichlorophenyl)pyrazole |
| 5-amino-4-cyano-1-(2,3,4-trichlorophenyl)-1H-pyrazole |
| 1H-Pyrazole-4-carbonitrile,5-amino-1-(2,3,4-trichlorophenyl) |
| 5-Amino-1-(2,3,4-trichlorophenyl)-1H-pyrazole-4-carbonitrile |
| EINECS 279-369-7 |