6-(3-Nitrophenyl)-picolinic acid
Modify Date: 2025-11-25 15:57:57
6-(3-Nitrophenyl)-picolinic acid structure
|
Common Name | 6-(3-Nitrophenyl)-picolinic acid | ||
|---|---|---|---|---|
| CAS Number | 80021-34-7 | Molecular Weight | 244.20300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(3-nitrophenyl)pyridine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8N2O4 |
|---|---|
| Molecular Weight | 244.20300 |
| Exact Mass | 244.04800 |
| PSA | 96.01000 |
| LogP | 2.87820 |
| InChIKey | RZDPUNHNZGWZNV-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(-c2cccc([N+](=O)[O-])c2)n1 |
| HS Code | 2933399090 |
|---|
|
~%
6-(3-Nitropheny... CAS#:80021-34-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 26, # 10 p. 1499 - 1504 |
|
~%
6-(3-Nitropheny... CAS#:80021-34-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 26, # 10 p. 1499 - 1504 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Pyridinecarboxylicacid,6-(3-nitrophenyl) |
| 6-(3-NITROPHENYL)-2-PYRIDINECARBOXYLIC ACID |
| 6-(3-Nitrophenyl)picolinic acid |