7-(β-D-ribofuranosyl)-2,3-dihydroimidazo<1,2-c>pyrazolo<4,3-e>pyrimidine structure
|
Common Name | 7-(β-D-ribofuranosyl)-2,3-dihydroimidazo<1,2-c>pyrazolo<4,3-e>pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 79974-32-6 | Molecular Weight | 293.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-(β-D-ribofuranosyl)-2,3-dihydroimidazo<1,2-c>pyrazolo<4,3-e>pyrimidine |
|---|
| Molecular Formula | C12H15N5O4 |
|---|---|
| Molecular Weight | 293.27900 |
| Exact Mass | 293.11200 |
| PSA | 117.92000 |
| InChIKey | WURRXMGWLICJTG-UHFFFAOYSA-N |
| SMILES | OCC1OC(n2ncc3c2N=CN2CCN=C32)C(O)C1O |
|
~68%
7-(β-D-ribofura... CAS#:79974-32-6 |
| Literature: Bhat, Ganapati A.; Townsend, Leroy B. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 2387 - 2393 |
|
~%
7-(β-D-ribofura... CAS#:79974-32-6 |
| Literature: Bhat, Ganapati A.; Townsend, Leroy B. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 2387 - 2393 |
|
~%
7-(β-D-ribofura... CAS#:79974-32-6 |
| Literature: Bhat, Ganapati A.; Townsend, Leroy B. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 2387 - 2393 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |