2-(3,4-dioxonaphthalen-1-yl)acetonitrile structure
|
Common Name | 2-(3,4-dioxonaphthalen-1-yl)acetonitrile | ||
|---|---|---|---|---|
| CAS Number | 79971-37-2 | Molecular Weight | 197.18900 | |
| Density | 1.301g/cm3 | Boiling Point | 390.8ºC at 760 mmHg | |
| Molecular Formula | C12H7NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.1ºC | |
| Name | 2-(3,4-dioxonaphthalen-1-yl)acetonitrile |
|---|
| Density | 1.301g/cm3 |
|---|---|
| Boiling Point | 390.8ºC at 760 mmHg |
| Molecular Formula | C12H7NO2 |
| Molecular Weight | 197.18900 |
| Flash Point | 190.1ºC |
| Exact Mass | 197.04800 |
| PSA | 57.93000 |
| LogP | 1.74908 |
| Index of Refraction | 1.604 |
| InChIKey | SLPMXVHDTVILCZ-UHFFFAOYSA-N |
| SMILES | N#CCC1=CC(=O)C(=O)c2ccccc21 |
|
~%
2-(3,4-dioxonap... CAS#:79971-37-2 |
| Literature: Gates; Newhall Journal of the American Chemical Society, 1948 , vol. 70, p. 2261 |
|
~%
2-(3,4-dioxonap... CAS#:79971-37-2 |
| Literature: Gates; Newhall Journal of the American Chemical Society, 1948 , vol. 70, p. 2261 |
|
~%
2-(3,4-dioxonap... CAS#:79971-37-2 |
| Literature: Gates et al. Journal of the American Chemical Society, 1950 , vol. 72, p. 1141,5803 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |