(S)-phosphoric acid Mono-[3-(4-benzyloxy-phenyl)-2-octadec-9-enoylamino-propyl] ester (amMonium salt)
Modify Date: 2025-09-11 11:04:14
![(S)-phosphoric acid Mono-[3-(4-benzyloxy-phenyl)-2-octadec-9-enoylamino-propyl] ester (amMonium salt) Structure](https://image.chemsrc.com/caspic/299/799268-73-8.png)
(S)-phosphoric acid Mono-[3-(4-benzyloxy-phenyl)-2-octadec-9-enoylamino-propyl] ester (amMonium salt) structure
|
Common Name | (S)-phosphoric acid Mono-[3-(4-benzyloxy-phenyl)-2-octadec-9-enoylamino-propyl] ester (amMonium salt) | ||
|---|---|---|---|---|
| CAS Number | 799268-73-8 | Molecular Weight | 635.815 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H58N3O6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (S)-phosphoric acid Mono-[3-(4-benzyloxy-phenyl)-2-octadec-9-enoylamino-propyl] ester (amMonium salt)Lysophosphatidic acids (LPAs) are bioactive lipid mediators. It interacts with at least six specific LPA receptors (LPA1-6) to mediate extracellular signaling pathway. LPA and its receptors (LPA1-3) are implicated in the pathogenesis of radiation pneumonitis (RP). VPC 12249 (S) inhibits the binding ofLPA to LPA1 and LPA3 receptor. |
| Name | Diammonium (2S)-3-[4-(benzyloxy)phenyl]-2-[(9Z)-9-octadecenoylamino]propyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C34H58N3O6P |
|---|---|
| Molecular Weight | 635.815 |
| Exact Mass | 635.406311 |
| InChIKey | YUXUSBLJZCYPMN-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NC(COP(=O)([O-])[O-])Cc1ccc(OCc2ccccc2)cc1.[NH4+].[NH4+] |
| Storage condition | 20°C |
| Diammonium (2S)-3-[4-(benzyloxy)phenyl]-2-[(9Z)-9-octadecenoylamino]propyl phosphate |
| 9-Octadecenamide, N-[(1S)-2-[4-(phenylmethoxy)phenyl]-1-[(phosphonooxy)methyl]ethyl]-, diammonium salt, (9Z)- |