1-Phenyl-2,2-di(4-toluidino)ethanone structure
|
Common Name | 1-Phenyl-2,2-di(4-toluidino)ethanone | ||
|---|---|---|---|---|
| CAS Number | 79866-34-5 | Molecular Weight | 330.42300 | |
| Density | 1.173g/cm3 | Boiling Point | 562.4ºC at 760 mmHg | |
| Molecular Formula | C22H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.2ºC | |
| Name | 2,2-bis(4-methylanilino)-1-phenylethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.173g/cm3 |
|---|---|
| Boiling Point | 562.4ºC at 760 mmHg |
| Molecular Formula | C22H22N2O |
| Molecular Weight | 330.42300 |
| Flash Point | 192.2ºC |
| Exact Mass | 330.17300 |
| PSA | 41.13000 |
| LogP | 5.18240 |
| Index of Refraction | 1.662 |
| InChIKey | UHDZIKNKIFXCEJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(Nc2ccc(C)cc2)C(=O)c2ccccc2)cc1 |
|
~74%
1-Phenyl-2,2-di... CAS#:79866-34-5 |
| Literature: McKay, William R.; Proctor, George R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 2435 - 2442 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| ACETOPHENONE,2,2-DI-p-TOLUIDINO |
| 2,2-di-(4-methylanilino)-1-phenylethanone |
| N,N'-(benzoylmethylene)di-p-toluidine |
| 2,2-Bis(p-toluidino)acetophenone |
| 2,2-Bis(4-methylanilino)acetophenone |
| 1-Phenyl-2,2-di(4-toluidino)ethanone |