3'',5''-DIBROMO-2,2,3,3,4,4,4-HEPTAFLUOROBUTYROPHENONE structure
|
Common Name | 3'',5''-DIBROMO-2,2,3,3,4,4,4-HEPTAFLUOROBUTYROPHENONE | ||
|---|---|---|---|---|
| CAS Number | 79851-20-0 | Molecular Weight | 431.92700 | |
| Density | 1.923g/cm3 | Boiling Point | 300.992ºC at 760 mmHg | |
| Molecular Formula | C10H3Br2F7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.835ºC | |
| Name | 1-(3,5-dibromophenyl)-2,2,3,3,4,4,4-heptafluorobutan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.923g/cm3 |
|---|---|
| Boiling Point | 300.992ºC at 760 mmHg |
| Molecular Formula | C10H3Br2F7O |
| Molecular Weight | 431.92700 |
| Flash Point | 135.835ºC |
| Exact Mass | 429.84400 |
| PSA | 17.07000 |
| LogP | 5.22720 |
| Index of Refraction | 1.464 |
| InChIKey | WYVCRFJVDBZRMR-UHFFFAOYSA-N |
| SMILES | O=C(c1cc(Br)cc(Br)c1)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3',5'-DIBROMO-2,2,3,3,4,4,4-HEPTAFLUOROBUTYROPHENONE |
| 1-(3,5-Dibromophenyl)perfluorobutan-1-one |
| 1-Butanone,1-(3,5-dibromophenyl)-2,2,3,3,4,4,4-heptafluoro |
| PC6697 |