4-[(2,4-dinitrophenyl)azo]-N-phenylnaphthalen-1-amine structure
|
Common Name | 4-[(2,4-dinitrophenyl)azo]-N-phenylnaphthalen-1-amine | ||
|---|---|---|---|---|
| CAS Number | 79811-55-5 | Molecular Weight | 413.38600 | |
| Density | 1.39g/cm3 | Boiling Point | 640.2ºC at 760 mmHg | |
| Molecular Formula | C22H15N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 341ºC | |
| Name | 4-[(2,4-dinitrophenyl)diazenyl]-N-phenylnaphthalen-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 640.2ºC at 760 mmHg |
| Molecular Formula | C22H15N5O4 |
| Molecular Weight | 413.38600 |
| Flash Point | 341ºC |
| Exact Mass | 413.11200 |
| PSA | 128.39000 |
| LogP | 7.93460 |
| Index of Refraction | 1.694 |
| InChIKey | LDNMUBGKPCFSHV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N=Nc2ccc(Nc3ccccc3)c3ccccc23)c([N+](=O)[O-])c1 |
|
~41%
4-[(2,4-dinitro... CAS#:79811-55-5 |
| Literature: Otutu Oriental Journal of Chemistry, 2011 , vol. 27, # 3 p. 1011 - 1016 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-[(2,4-DINITROPHENYL)AZO]-N-PHENYLNAPHTHALEN-1-AMINE |
| 2,4-dinitrophenyl azo N-phenylnaphthalen-1-amine |
| 4-(2,4-dinitrophenyl)diazenyl-N-phenylnaphthalen-1-amine |