2-(3,4-dichlorophenyl)imino-1-phenyl-ethanone structure
|
Common Name | 2-(3,4-dichlorophenyl)imino-1-phenyl-ethanone | ||
|---|---|---|---|---|
| CAS Number | 79807-20-8 | Molecular Weight | 278.13300 | |
| Density | 1.25g/cm3 | Boiling Point | 425.7ºC at 760 mmHg | |
| Molecular Formula | C14H9Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.7ºC | |
| Name | 2-(3,4-dichlorophenyl)imino-1-phenylethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 425.7ºC at 760 mmHg |
| Molecular Formula | C14H9Cl2NO |
| Molecular Weight | 278.13300 |
| Flash Point | 167.7ºC |
| Exact Mass | 277.00600 |
| PSA | 29.43000 |
| LogP | 4.57860 |
| Index of Refraction | 1.592 |
| InChIKey | KNEQGIKSBWSOFR-UHFFFAOYSA-N |
| SMILES | O=C(C=Nc1ccc(Cl)c(Cl)c1)c1ccccc1 |
|
~%
2-(3,4-dichloro... CAS#:79807-20-8 |
| Literature: McKay, William R.; Proctor, George R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 2435 - 2442 |
|
~71%
2-(3,4-dichloro... CAS#:79807-20-8 |
| Literature: McKay, William R.; Proctor, George R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 2435 - 2442 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,4-dichloro-N-phenacylideneaniline |