1-hydroxy-5-methoxynaphthalene-2-carboxylic acid structure
|
Common Name | 1-hydroxy-5-methoxynaphthalene-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 79786-98-4 | Molecular Weight | 218.20500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-hydroxy-5-methoxynaphthalene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H10O4 |
|---|---|
| Molecular Weight | 218.20500 |
| Exact Mass | 218.05800 |
| PSA | 66.76000 |
| LogP | 2.25220 |
| InChIKey | JFYMESHFUIIOOE-UHFFFAOYSA-N |
| SMILES | COc1cccc2c(O)c(C(=O)O)ccc12 |
|
~58%
1-hydroxy-5-met... CAS#:79786-98-4 |
| Literature: Wurm; Geres; Schmidt Archiv der Pharmazie, 1981 , vol. 314, # 10 p. 861 - 867 |
|
~%
1-hydroxy-5-met... CAS#:79786-98-4 |
| Literature: Hill; Short; Stromberg Journal of the Chemical Society, 1937 , p. 937,939 |
| 1-Hydroxy-5-methoxynaphthalin-2-carbonsaeure |
| 1-Hydroxy-5-methoxy-[2]naphthoesaeure |
| 2-Naphthalenecarboxylicacid,1-hydroxy-5-methoxy |
| 1-Hydroxy-5-methoxy-2-naphthalenecarboxylic acid |
| 1-hydroxy-5-methoxy-[2]naphthoic acid |