Amidepsine D
Modify Date: 2025-11-30 16:14:19
Amidepsine D structure
|
Common Name | Amidepsine D | ||
|---|---|---|---|---|
| CAS Number | 79786-34-8 | Molecular Weight | 496.46300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H24O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Amidepsine DAmidepsine D is a fungal metabolite isolated from the culture broth of Humicola sp. FO-2942 that inhibits Diacylglycerol acyltransferases (DGAT) activity[1]. |
| Name | 2,4-di-O-methylgyrophoric acid |
|---|---|
| Synonym | More Synonyms |
| Description | Amidepsine D is a fungal metabolite isolated from the culture broth of Humicola sp. FO-2942 that inhibits Diacylglycerol acyltransferases (DGAT) activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C26H24O10 |
|---|---|
| Molecular Weight | 496.46300 |
| Exact Mass | 496.13700 |
| PSA | 148.82000 |
| LogP | 4.17680 |
| InChIKey | KODVVMZOLYYCMV-UHFFFAOYSA-N |
| SMILES | COc1cc(C)c(C(=O)Oc2cc(C)c(C(=O)Oc3cc(C)c(C(=O)O)c(O)c3)c(O)c2)c(OC)c1 |
| Amidepsine D, Humcola sp |
| AMIDEPSINE D |
| Amidepsine D |