4,5-bis(4-methoxyphenyl)-5-oxopentanoic acid (en)Benzenepentanoic acid, 4-methoxy-.γ.-(4-methoxyphenyl)-.δ.-oxo- (en) structure
|
Common Name | 4,5-bis(4-methoxyphenyl)-5-oxopentanoic acid (en)Benzenepentanoic acid, 4-methoxy-.γ.-(4-methoxyphenyl)-.δ.-oxo- (en) | ||
|---|---|---|---|---|
| CAS Number | 79754-51-1 | Molecular Weight | 328.35900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,5-bis(4-methoxyphenyl)-5-oxopentanoic acid (en)Benzenepentanoic acid, 4-methoxy-.γ.-(4-methoxyphenyl)-.δ.-oxo- (en) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H20O5 |
|---|---|
| Molecular Weight | 328.35900 |
| Exact Mass | 328.13100 |
| PSA | 72.83000 |
| LogP | 3.53510 |
| InChIKey | BISBROXWWHXOAG-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)C(CCC(=O)O)c2ccc(OC)cc2)cc1 |
|
~62%
4,5-bis(4-metho... CAS#:79754-51-1 |
| Literature: Reddy, M. Parameswara; Rao, G. S. Krishna Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 2662 - 2665 |
|
~%
4,5-bis(4-metho... CAS#:79754-51-1 |
| Literature: Reddy, M. Parameswara; Rao, G. S. Krishna Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 2662 - 2665 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,4-Pyridinedimethanethiol,5-hydroxy-6-methyl-,hydrochloride |
| 4,5-bis-p-methoxyphenyl-5-oxopentanoic acid |
| 4,5-bis-mercaptomethyl-2-methyl-pyridin-3-ol,hydrochloride |
| 4,5-Dimercaptopyridoxin hydrochlorid |