1,4-Piperazinediaceticacid, 2-(aminocarbonyl)-3-[(2-ethoxy-2-oxoethoxy)carbonyl]-, diethyl ester,cis- (9CI) structure
|
Common Name | 1,4-Piperazinediaceticacid, 2-(aminocarbonyl)-3-[(2-ethoxy-2-oxoethoxy)carbonyl]-, diethyl ester,cis- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 79744-12-0 | Molecular Weight | 431.43800 | |
| Density | 1.247g/cm3 | Boiling Point | 566.3ºC at 760mmHg | |
| Molecular Formula | C18H29N3O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296.3ºC | |
| Name | (2-ethoxy-2-oxoethyl) 3-carbamoyl-1,4-bis(2-ethoxy-2-oxoethyl)piperazine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.247g/cm3 |
|---|---|
| Boiling Point | 566.3ºC at 760mmHg |
| Molecular Formula | C18H29N3O9 |
| Molecular Weight | 431.43800 |
| Flash Point | 296.3ºC |
| Exact Mass | 431.19000 |
| PSA | 154.77000 |
| Index of Refraction | 1.496 |
| InChIKey | BZAGVTHVTJIHLT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COC(=O)C1C(C(N)=O)N(CC(=O)OCC)CCN1CC(=O)OCC |
|
~54%
1,4-Piperazined... CAS#:79744-12-0 |
| Literature: Witiak, Donald T.; Trivedi, Bharat K.; Campolito, Laura B.; Zwilling, Bruce S.; Reiches, Nancy A. Journal of Medicinal Chemistry, 1981 , vol. 24, # 11 p. 1329 - 1332 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| diethyl cis-2-(aminocarbonyl)-3-[(2-ethoxy-2-oxoethoxy)carbonyl]-1,4-piperazinediacetate |
| (2-ethoxy-2-oxoethyl) (2R,3S)-3-carbamoyl-1,4-bis(2-ethoxy-2-oxoethyl)piperazine-2-carboxylate |