7,7-dimethyl-10-phenylsulfanyldec-9-en-5-one structure
|
Common Name | 7,7-dimethyl-10-phenylsulfanyldec-9-en-5-one | ||
|---|---|---|---|---|
| CAS Number | 79681-41-7 | Molecular Weight | 290.46300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H26OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7,7-dimethyl-10-phenylsulfanyldec-9-en-5-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H26OS |
|---|---|
| Molecular Weight | 290.46300 |
| Exact Mass | 290.17000 |
| PSA | 42.37000 |
| LogP | 5.85810 |
| InChIKey | PWRPPTPHUADEGE-UHFFFAOYSA-N |
| SMILES | CCCCC(=O)CC(C)(C)CC=CSc1ccccc1 |
|
~%
7,7-dimethyl-10... CAS#:79681-41-7 |
| Literature: Shimizu, Makoto; Ando, Ryoichi; Kuwajima, Isao Journal of Organic Chemistry, 1981 , vol. 46, p. 5246 - 5248 |
|
~63%
7,7-dimethyl-10... CAS#:79681-41-7 |
| Literature: Shimizu, Makoto; Ando, Ryoichi; Kuwajima, Isao Journal of Organic Chemistry, 1984 , vol. 49, # 7 p. 1230 - 1238 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 9-Decen-5-one,7,7-dimethyl-10-(phenylthio) |
| 6,6-Dimethyl-10-(phenylthio)-9-decen-5-one |
| 7,7-dimethyl-10-(phenylthio)-9-decen-5-one |