2,3-Dihydrobenzofuran-5-ethanol Tosylate
Modify Date: 2025-08-21 15:47:41
2,3-Dihydrobenzofuran-5-ethanol Tosylate structure
|
Common Name | 2,3-Dihydrobenzofuran-5-ethanol Tosylate | ||
|---|---|---|---|---|
| CAS Number | 79679-49-5 | Molecular Weight | 318.38700 | |
| Density | 1.267g/cm3 | Boiling Point | 491.7ºC at 760 mmHg | |
| Molecular Formula | C17H18O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.1ºC | |
| Name | 2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.267g/cm3 |
|---|---|
| Boiling Point | 491.7ºC at 760 mmHg |
| Molecular Formula | C17H18O4S |
| Molecular Weight | 318.38700 |
| Flash Point | 251.1ºC |
| Exact Mass | 318.09300 |
| PSA | 60.98000 |
| LogP | 3.95870 |
| Index of Refraction | 1.59 |
| InChIKey | DKYSYGFCWXQFGH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCc2ccc3c(c2)CCO3)cc1 |
| HS Code | 2932999099 |
|---|
|
~%
2,3-Dihydrobenz... CAS#:79679-49-5 |
| Literature: EP999205 A1, ; EP 0999205 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Darifenacin Intermediate 3 |
| 5-(2-tosyloxyethyl)-2,3-dihydrobenzofuran |
| 2,3-Dihydrobenzofuran-5-ethanol Tosylate |
| 2-(2,3-dihydrobenzofuran-5-yl)ethyl tosylate |
| 2-(2,3-dihidrobenzofuran-5-yl)ethyl tosylate |