Benzamide,4-[(2,3-dihydro-2-hydroxy-1H-inden-1-yl)amino]-N,N-dimethyl- structure
|
Common Name | Benzamide,4-[(2,3-dihydro-2-hydroxy-1H-inden-1-yl)amino]-N,N-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 796-55-4 | Molecular Weight | 296.36400 | |
| Density | 1.257g/cm3 | Boiling Point | 532.5ºC at 760 mmHg | |
| Molecular Formula | C18H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.8ºC | |
| Name | 4-((2-hydroxy-2,3-dihydro-1H-inden-1-yl)amino)-N,N-dimethylbenzamide |
|---|
| Density | 1.257g/cm3 |
|---|---|
| Boiling Point | 532.5ºC at 760 mmHg |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.36400 |
| Flash Point | 275.8ºC |
| Exact Mass | 296.15200 |
| PSA | 52.57000 |
| LogP | 2.53160 |
| Index of Refraction | 1.665 |
| InChIKey | GHEYFMSXSCJANW-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)c1ccc(NC2c3ccccc3CC2O)cc1 |
|
~%
Benzamide,4-[(2... CAS#:796-55-4 |
| Literature: Sam,J.; Snapp,T.C. Journal of Pharmaceutical Sciences, 1964 , vol. 53, p. 1364 - 1367 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |