5-(4-(Benzyloxy)phenyl)-1H-pyrazole-3-carboxylic acid
Modify Date: 2025-09-03 12:48:56
5-(4-(Benzyloxy)phenyl)-1H-pyrazole-3-carboxylic acid structure
|
Common Name | 5-(4-(Benzyloxy)phenyl)-1H-pyrazole-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 795260-68-3 | Molecular Weight | 294.305 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 590.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 310.8±30.1 °C | |
| Name | 3-(4-phenylmethoxyphenyl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 590.3±50.0 °C at 760 mmHg |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.305 |
| Flash Point | 310.8±30.1 °C |
| Exact Mass | 294.100433 |
| PSA | 75.21000 |
| LogP | 3.36 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | JFCYETQEMDKJAU-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2ccc(OCc3ccccc3)cc2)n[nH]1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-[4-(Benzyloxy)phenyl]-1H-pyrazole-3-carboxylic acid |
| 5-(4-Benzyloxyphenyl)-1H-pyrazole-3-carboxylic acid |
| 1H-Pyrazole-3-carboxylic acid, 5-[4-(phenylmethoxy)phenyl]- |
| RW2323 |