2-[(4-oxo-1-cyclohexa-2,5-dienylidene)methylamino]isoindole-1,3-dione structure
|
Common Name | 2-[(4-oxo-1-cyclohexa-2,5-dienylidene)methylamino]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 79492-27-6 | Molecular Weight | 266.25200 | |
| Density | 1.44g/cm3 | Boiling Point | 460.4ºC at 760 mmHg | |
| Molecular Formula | C15H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.2ºC | |
| Name | 2-[(4-oxocyclohexa-2,5-dien-1-ylidene)methylamino]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 460.4ºC at 760 mmHg |
| Molecular Formula | C15H10N2O3 |
| Molecular Weight | 266.25200 |
| Flash Point | 232.2ºC |
| Exact Mass | 266.06900 |
| PSA | 69.97000 |
| LogP | 1.96020 |
| Index of Refraction | 1.703 |
| InChIKey | UFAPHVMNWBAQAP-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1N=Cc1ccc(O)cc1 |
|
~77%
2-[(4-oxo-1-cyc... CAS#:79492-27-6 |
| Literature: Salman, Mohammad; Ray, Suprabhat Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1981 , vol. 20, # 6 p. 477 - 479 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-(p-hydroxybenzylidene)aminophthalimide |
| 2-((4-Hydroxybenzylidene)amino)-1H-isoindole-1,3(2H)-dione |