1-(2-hydroxyethylsulfanyl)-N-(4-phenyldiazenylphenyl)formamide
Modify Date: 2025-09-29 15:05:06
1-(2-hydroxyethylsulfanyl)-N-(4-phenyldiazenylphenyl)formamide structure
|
Common Name | 1-(2-hydroxyethylsulfanyl)-N-(4-phenyldiazenylphenyl)formamide | ||
|---|---|---|---|---|
| CAS Number | 79479-13-3 | Molecular Weight | 301.36400 | |
| Density | 1.25g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H15N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | S-(2-hydroxyethyl) N-(4-phenyldiazenylphenyl)carbamothioate |
|---|
| Density | 1.25g/cm3 |
|---|---|
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.36400 |
| Exact Mass | 301.08800 |
| PSA | 99.35000 |
| LogP | 4.43240 |
| Index of Refraction | 1.627 |
| InChIKey | YHUWMUTVSZKEJE-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(N=Nc2ccccc2)cc1)SCCO |
|
~82%
1-(2-hydroxyeth... CAS#:79479-13-3 |
| Literature: Dalton, John R.; Kirkpatrick, Alan; Maclaren, John A. Australian Journal of Chemistry, 1981 , vol. 34, # 4 p. 759 - 764 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |