[3-(2-Methoxy-phenoxy)-2-methyl-propyl]-dimethyl-amine; compound with (Z)-but-2-enedioic acid structure
|
Common Name | [3-(2-Methoxy-phenoxy)-2-methyl-propyl]-dimethyl-amine; compound with (Z)-but-2-enedioic acid | ||
|---|---|---|---|---|
| CAS Number | 79306-60-8 | Molecular Weight | 339.38400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H25NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [3-(2-Methoxy-phenoxy)-2-methyl-propyl]-dimethyl-amine; compound with (Z)-but-2-enedioic acid |
|---|
| Molecular Formula | C17H25NO6 |
|---|---|
| Molecular Weight | 339.38400 |
| Exact Mass | 339.16800 |
| PSA | 96.30000 |
| LogP | 1.98350 |
| InChIKey | FMLYNVXKWQAPDP-WLHGVMLRSA-N |
| SMILES | COc1ccccc1OCC(C)CN(C)C.O=C(O)C=CC(=O)O |