methyl 7-methyl-9,9-dioxo-8-oxa-9$l^{6}-thiabicyclo[4.3.0]nona-1,3,5-triene-7-carboxylate structure
|
Common Name | methyl 7-methyl-9,9-dioxo-8-oxa-9$l^{6}-thiabicyclo[4.3.0]nona-1,3,5-triene-7-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 79253-78-4 | Molecular Weight | 242.24800 | |
| Density | 1.406g/cm3 | Boiling Point | 357.9ºC at 760 mmHg | |
| Molecular Formula | C10H10O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.3ºC | |
| Name | methyl 3-methyl-1,1-dioxo-2,1λ6-benzoxathiole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.406g/cm3 |
|---|---|
| Boiling Point | 357.9ºC at 760 mmHg |
| Molecular Formula | C10H10O5S |
| Molecular Weight | 242.24800 |
| Flash Point | 170.3ºC |
| Exact Mass | 242.02500 |
| PSA | 78.05000 |
| LogP | 1.87450 |
| Index of Refraction | 1.559 |
| InChIKey | QMFREQKSBRDOOS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(C)OS(=O)(=O)c2ccccc21 |
|
~40%
methyl 7-methyl... CAS#:79253-78-4 |
| Literature: Sundberg, Richard J.; Broome, Rita; Walters, Claudia Powers; Schnur, Dora Journal of Heterocyclic Chemistry, 1981 , vol. 18, p. 807 - 809 |
|
~%
methyl 7-methyl... CAS#:79253-78-4 |
| Literature: Sundberg, Richard J.; Broome, Rita; Walters, Claudia Powers; Schnur, Dora Journal of Heterocyclic Chemistry, 1981 , vol. 18, p. 807 - 809 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Methyl 3-methyl-3H-2,1-benzoxathiole-3-carboxylate 1,1-dioxide |
| methyl 3-methyl-1,1-dioxo-2,1 |