Ethyl 4-(Trifluoromethyl)thiazole-2-carboxylate structure
|
Common Name | Ethyl 4-(Trifluoromethyl)thiazole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 79247-86-2 | Molecular Weight | 225.188 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 239.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C7H6F3NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 98.5±30.1 °C | |
| Name | Ethyl 4-(Trifluoromethyl)thiazole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 239.3±50.0 °C at 760 mmHg |
| Molecular Formula | C7H6F3NO2S |
| Molecular Weight | 225.188 |
| Flash Point | 98.5±30.1 °C |
| Exact Mass | 225.007126 |
| PSA | 67.43000 |
| LogP | 1.92 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.463 |
| InChIKey | PSTFYCCCZHOTHW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1nc(C(F)(F)F)cs1 |
| HS Code | 2934100090 |
|---|
|
~%
Ethyl 4-(Triflu... CAS#:79247-86-2 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , p. 2335 - 2339 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-Thiazolecarboxylic acid, 4-(trifluoromethyl)-, ethyl ester |
| Ethyl 4-(trifluoromethyl)-1,3-thiazole-2-carboxylate |