2-Thiazolecarboxylicacid,5-bromo-4-(trifluoromethyl)-,methylester(9CI)
Modify Date: 2025-09-09 21:19:20
2-Thiazolecarboxylicacid,5-bromo-4-(trifluoromethyl)-,methylester(9CI) structure
|
Common Name | 2-Thiazolecarboxylicacid,5-bromo-4-(trifluoromethyl)-,methylester(9CI) | ||
|---|---|---|---|---|
| CAS Number | 79247-83-9 | Molecular Weight | 290.05800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H3BrF3NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 5-bromo-4-(trifluoromethyl)-1,3-thiazole-2-carboxylate |
|---|
| Molecular Formula | C6H3BrF3NO2S |
|---|---|
| Molecular Weight | 290.05800 |
| Exact Mass | 288.90200 |
| PSA | 67.43000 |
| LogP | 2.71100 |
| InChIKey | FAPZBEQEVDOFCG-UHFFFAOYSA-N |
| SMILES | COC(=O)c1nc(C(F)(F)F)c(Br)s1 |
| HS Code | 2934100090 |
|---|
|
~%
2-Thiazolecarbo... CAS#:79247-83-9
Detail
|
| Literature: Kaye, Perry T.; Meakins, G. Denis; Willbe, Charles; Williams, Peter R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 2335 - 2339 |
|
~%
Detail
|
| Literature: Kaye, Perry T.; Meakins, G. Denis; Willbe, Charles; Williams, Peter R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 2335 - 2339 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |