1-(4-METHYLBENZYL)-1H-INDOLE-2,3-DIONE
Modify Date: 2025-08-29 16:48:05
1-(4-METHYLBENZYL)-1H-INDOLE-2,3-DIONE structure
|
Common Name | 1-(4-METHYLBENZYL)-1H-INDOLE-2,3-DIONE | ||
|---|---|---|---|---|
| CAS Number | 79183-26-9 | Molecular Weight | 251.28000 | |
| Density | 1.274g/cm3 | Boiling Point | 429.3ºC at 760 mmHg | |
| Molecular Formula | C16H13NO2 | Melting Point | 144-146ºC | |
| MSDS | N/A | Flash Point | 198.7ºC | |
| Name | 1-[(4-methylphenyl)methyl]indole-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.274g/cm3 |
|---|---|
| Boiling Point | 429.3ºC at 760 mmHg |
| Melting Point | 144-146ºC |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28000 |
| Flash Point | 198.7ºC |
| Exact Mass | 251.09500 |
| PSA | 37.38000 |
| LogP | 2.78950 |
| Index of Refraction | 1.646 |
| InChIKey | UOSUSTXEXDHJEO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(CN2C(=O)C(=O)c3ccccc32)cc1 |
| HS Code | 2933990090 |
|---|
|
~%
1-(4-METHYLBENZ... CAS#:79183-26-9 |
| Literature: Tetrahedron, , vol. 67, # 35 p. 6713 - 6729 |
|
~%
1-(4-METHYLBENZ... CAS#:79183-26-9 |
| Literature: Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, , p. 459,465, 466; engl. Ausg. S. 443, 448 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methylbenzylindoledione |
| 1-[(4-methylphenyl)methyl]-1H-indole-2,3-dione |
| 1-[(4-methylphenyl)methyl]benzo[d]azoline-2,3-dione |
| 1-(4-Methyl-benzyl)-indolin-2,3-dion |
| 1-(4-methyl-benzyl)-indoline-2,3-dione |
| 1-(4-methylbenzyl)-1H-indole-2,3-dione |
| 1-(4-methylbenzyl)isatin |