4-chloro-N-(1,3-thiazol-2-yl)benzamide structure
|
Common Name | 4-chloro-N-(1,3-thiazol-2-yl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 79146-99-9 | Molecular Weight | 238.69300 | |
| Density | 1.464g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H7ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | p-Chlor-benzoesaeure-p-tolylester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.464g/cm3 |
|---|---|
| Molecular Formula | C10H7ClN2OS |
| Molecular Weight | 238.69300 |
| Exact Mass | 237.99700 |
| PSA | 70.23000 |
| LogP | 3.12180 |
| Index of Refraction | 1.688 |
| InChIKey | PMLPORHMVWQTCZ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1nccs1)c1ccc(Cl)cc1 |
| HS Code | 2934100090 |
|---|
|
~81%
4-chloro-N-(1,3... CAS#:79146-99-9 |
| Literature: Andreani, Aldo; Leoni, Alberto; Locatelli, Alessandra; Morigi, Rita; Rambaldi, Mirella; Gehret, Jean-Claude; Traniello, Serena; Cariani, Alessio; Spisani, Susanna Collection of Czechoslovak Chemical Communications, 1999 , vol. 64, # 2 p. 299 - 312 |
|
~%
4-chloro-N-(1,3... CAS#:79146-99-9 |
| Literature: Takatori Yakugaku Zasshi, 1953 , vol. 73, p. 810,811 Chem.Abstr., 1954 , p. 8749 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-methylphenyl 4-chlorobenzoate |
| 4-chloro-benzoic acid,4-methylphenyl ester |
| 4-chloro-benzoic acid thiazol-2-ylamide |
| 4-Chlor-benzoesaeure-thiazol-2-ylamid |
| 4-chloro-benzoic acid p-tolyl ester |
| 4-Chlor-benzoesaeure-p-tolylester |
| p-tolyl 4-chlorobenzoate |