tert-butyl 4-(2-aminobenzylamino)piperidine-1-carboxylate structure
|
Common Name | tert-butyl 4-(2-aminobenzylamino)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 79098-98-9 | Molecular Weight | 305.41500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H27N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Methyl-2-propanyl 4-[(2-aminobenzyl)amino]-1-piperidinecarboxyl ate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H27N3O2 |
|---|---|
| Molecular Weight | 305.41500 |
| Exact Mass | 305.21000 |
| PSA | 67.59000 |
| LogP | 3.66790 |
| InChIKey | UNFNKTIJBMXYGB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(NCc2ccccc2N)CC1 |
| Storage condition | 2-8°C |
|
~79%
tert-butyl 4-(2... CAS#:79098-98-9 |
| Literature: Obase; Takai; Teranishi; Nakamizo Journal of Heterocyclic Chemistry, 1983 , vol. 20, # 3 p. 565 - 573 |
|
~%
tert-butyl 4-(2... CAS#:79098-98-9 |
| Literature: Obase; Takai; Teranishi; Nakamizo Journal of Heterocyclic Chemistry, 1983 , vol. 20, # 3 p. 565 - 573 |
|
~%
tert-butyl 4-(2... CAS#:79098-98-9 |
| Literature: Obase; Takai; Teranishi; Nakamizo Journal of Heterocyclic Chemistry, 1983 , vol. 20, # 3 p. 565 - 573 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-Boc-4-(3-Oxo-3-phenylpropenyl)piperidine |
| 1,1-dimethylethyl 4-[(1E)-3-oxo-3-phenyl-1-propenyl]-1-Piperidinecarboxylate |
| tert-butyl 4-[(1E)-3-oxo-3-phenylprop-1-en-1-yl]piperidine-1-carboxylate |
| 1-t-butoxycarbonyl-4-(2-aminophenylmethyl)aminopiperidine |
| tert-Butyl 4-(2-aminobenzylamino)piperidine-1-carboxylate |
| 1-(tert-butoxycarbonyl)-4-(3-oxo-3-phenylprop-1-enyl)piperidine |
| tert-butyl (S)-4-(1-aminoethyl)benzoate |