dichloro-phenyl-propan-2-ylsilane structure
|
Common Name | dichloro-phenyl-propan-2-ylsilane | ||
|---|---|---|---|---|
| CAS Number | 790234-74-1 | Molecular Weight | 219.18300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12Cl2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dichloro-phenyl-propan-2-ylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H12Cl2Si |
|---|---|
| Molecular Weight | 219.18300 |
| Exact Mass | 218.00900 |
| LogP | 3.22340 |
| InChIKey | FGWXDFWPKXPWND-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](Cl)(Cl)c1ccccc1 |
|
~83%
dichloro-phenyl... CAS#:790234-74-1 |
| Literature: Unno, Masafumi; Kawaguchi, Yasuaki; Kishimoto, Yukiko; Matsumoto, Hideyuki Journal of the American Chemical Society, 2005 , vol. 127, # 7 p. 2256 - 2263 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| dichloroisopropylphenylsilane |
| Silane,dichloro(1-methylethyl)phenyl |
| Dichlorisopropylphenylsilan |