1,1,3,3-Tetrachloro-1,3-difluoroacetone structure
|
Common Name | 1,1,3,3-Tetrachloro-1,3-difluoroacetone | ||
|---|---|---|---|---|
| CAS Number | 79-51-6 | Molecular Weight | 231.840 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 144.3±35.0 °C at 760 mmHg | |
| Molecular Formula | C3Cl4F2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 41.1±25.9 °C | |
| Name | 1,1,3,3-tetrachloro-1,3-difluoropropan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 144.3±35.0 °C at 760 mmHg |
| Molecular Formula | C3Cl4F2O |
| Molecular Weight | 231.840 |
| Flash Point | 41.1±25.9 °C |
| Exact Mass | 229.867126 |
| PSA | 17.07000 |
| LogP | 6.29 |
| Vapour Pressure | 5.1±0.3 mmHg at 25°C |
| Index of Refraction | 1.454 |
| InChIKey | MXYOKVCIXGJEFW-UHFFFAOYSA-N |
| SMILES | O=C(C(F)(Cl)Cl)C(F)(Cl)Cl |
|
~%
1,1,3,3-Tetrach... CAS#:79-51-6 |
| Literature: US2853524 , ; |
| Precursor 1 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1,1-Difluoro-1,1,2,2-tetrachloroacetone |
| Tetrachlor-1,3-difluor-aceton |
| 2-Propanone, 1,1,3,3-tetrachloro-1,3-difluoro- |
| 1,1,3,3-Tetrachloro-1,3-difluoroacetone |
| Difluorotetrachloroacetone |
| MFCD00018816 |
| 1,3-Difluorotetrachloroacetone |
| tetrachloro-1,3-difluoro-acetone |
| 1,1,3,3-tetrachloro-1,3-difluoro-propan-2-one |
| 1,3-Difluor-1,1,3,3,-tetrachlor-aceton |
| 1,1,3,3-tetrachloro-1,3-difluoro-2-propanone |