2-(4-Bromophenoxy)-5-nitrobenzonitrile
Modify Date: 2025-09-29 00:30:45
2-(4-Bromophenoxy)-5-nitrobenzonitrile structure
|
Common Name | 2-(4-Bromophenoxy)-5-nitrobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 78940-64-4 | Molecular Weight | 319.11000 | |
| Density | 1.67g/cm3 | Boiling Point | 399.2ºC at 760 mmHg | |
| Molecular Formula | C13H7BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.2ºC | |
| Name | 2-(4-Bromophenoxy)-5-nitrobenzonitrile |
|---|
| Density | 1.67g/cm3 |
|---|---|
| Boiling Point | 399.2ºC at 760 mmHg |
| Molecular Formula | C13H7BrN2O3 |
| Molecular Weight | 319.11000 |
| Flash Point | 195.2ºC |
| Exact Mass | 317.96400 |
| PSA | 78.84000 |
| LogP | 4.54448 |
| Index of Refraction | 1.672 |
| InChIKey | XXYYTKATSBRQRD-UHFFFAOYSA-N |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1Oc1ccc(Br)cc1 |
|
~%
2-(4-Bromopheno... CAS#:78940-64-4 |
| Literature: The Dow Chemical Company Patent: US4332820 A1, 1982 ; |
