2-[(4-nitrophenyl)methylsulfanyl]-3H-pyrimidin-4-one structure
|
Common Name | 2-[(4-nitrophenyl)methylsulfanyl]-3H-pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 78932-23-7 | Molecular Weight | 263.27200 | |
| Density | 1.46g/cm3 | Boiling Point | 509ºC at 760 mmHg | |
| Molecular Formula | C11H9N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.6ºC | |
| Name | 2-[(4-nitrophenyl)methylsulfanyl]-1H-pyrimidin-6-one |
|---|
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 509ºC at 760 mmHg |
| Molecular Formula | C11H9N3O3S |
| Molecular Weight | 263.27200 |
| Flash Point | 261.6ºC |
| Exact Mass | 263.03600 |
| PSA | 116.87000 |
| LogP | 2.49360 |
| Index of Refraction | 1.69 |
| InChIKey | UNSOILCRMHBRPW-UHFFFAOYSA-N |
| SMILES | O=c1ccnc(SCc2ccc([N+](=O)[O-])cc2)[nH]1 |
|
~73%
2-[(4-nitrophen... CAS#:78932-23-7 |
| Literature: Wyrzynkiewicz, Elzbieta; Stobiecki, Maciej; Golankiewicz, Krzysztof Polish Journal of Chemistry, 1981 , vol. 55, # 7/8 p. 1673 - 1676 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |