1-Isobutyl-1H-indole-2,3-dione
Modify Date: 2025-08-27 03:04:18
1-Isobutyl-1H-indole-2,3-dione structure
|
Common Name | 1-Isobutyl-1H-indole-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 78846-77-2 | Molecular Weight | 203.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-Isobutyl-1H-indole-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13NO2 |
|---|---|
| Molecular Weight | 203.23700 |
| Exact Mass | 203.09500 |
| PSA | 37.38000 |
| LogP | 1.93690 |
| InChIKey | NZLZSOVOTGYGAY-UHFFFAOYSA-N |
| SMILES | CC(C)CN1C(=O)C(=O)c2ccccc21 |
| HS Code | 2933990090 |
|---|
|
~%
1-Isobutyl-1H-i... CAS#:78846-77-2 |
| Literature: ASTRAZENECA AB Patent: WO2007/91946 A1, 2007 ; Location in patent: Page/Page column 30-31 ; WO 2007/091946 A1 |
|
~%
1-Isobutyl-1H-i... CAS#:78846-77-2 |
| Literature: Sharma, Rashmi; Pandey, Anand Kumar; Shivahare, Rahul; Srivastava, Khushboo; Gupta, Suman; Chauhan, Prem M.S. Bioorganic and Medicinal Chemistry Letters, 2014 , vol. 24, # 1 p. 298 - 301 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Isobutyl-1H-benzoimidazole |
| 1-isobutylbenzimidazole |
| (2-methylpropyl)benzimidazole |
| 1-isobutylisatin |
| 1-Isobutyl-1H-benzimidazole |