9,10-Anthracenediol,1,4-dimethoxy- structure
|
Common Name | 9,10-Anthracenediol,1,4-dimethoxy- | ||
|---|---|---|---|---|
| CAS Number | 78846-44-3 | Molecular Weight | 270.28000 | |
| Density | 1.334g/cm3 | Boiling Point | 538.3ºC at 760mmHg | |
| Molecular Formula | C16H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.3ºC | |
| Name | 1,4-dimethoxyanthracene-9,10-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.334g/cm3 |
|---|---|
| Boiling Point | 538.3ºC at 760mmHg |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28000 |
| Flash Point | 279.3ºC |
| Exact Mass | 270.08900 |
| PSA | 58.92000 |
| LogP | 3.42140 |
| Index of Refraction | 1.709 |
| InChIKey | JNYWSRZISOMFFQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c2c(O)c3ccccc3c(O)c12 |
|
~91%
9,10-Anthracene... CAS#:78846-44-3 |
| Literature: Boniface, Peter J.; Cambie, Richard C.; Carroll, David R.; Marsh, Nicholas F.; Milbank, Jared B. J.; et al. Australian Journal of Chemistry, 1994 , vol. 47, # 3 p. 441 - 450 |
| 1,4-Dimethoxy-9,10-dihydroxy-anthracen |
| 1,4-Dimethoxy-anthracen-9,10-diol |
| 1,4-dimethoxy-anthracene-9,10-diol |
| Leuko-1,4-dimethoxy-anthrachinon |