2-(4-Methoxyphenyl)-4-methyl-7H-1-benzopyran-7-one
Modify Date: 2025-10-20 17:08:54
2-(4-Methoxyphenyl)-4-methyl-7H-1-benzopyran-7-one structure
|
Common Name | 2-(4-Methoxyphenyl)-4-methyl-7H-1-benzopyran-7-one | ||
|---|---|---|---|---|
| CAS Number | 78776-49-5 | Molecular Weight | 266.29100 | |
| Density | 1.24g/cm3 | Boiling Point | 536.3ºC at 760 mmHg | |
| Molecular Formula | C17H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.7ºC | |
| Name | 2-(4-methoxyphenyl)-4-methylchromen-7-one |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 536.3ºC at 760 mmHg |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.29100 |
| Flash Point | 270.7ºC |
| Exact Mass | 266.09400 |
| PSA | 39.44000 |
| LogP | 3.72860 |
| Index of Refraction | 1.625 |
| InChIKey | OBJPLSGIYZNSSM-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(C)c3ccc(=O)cc-3o2)cc1 |
|
~%
2-(4-Methoxyphe... CAS#:78776-49-5 |
| Literature: Brouillard, R.; Iacobucci, G. A.; Sweeny, J. G. Journal of the American Chemical Society, 1982 , vol. 104, # 26 p. 7585 - 7590 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |