trimethyl-(2-trimethylsilyloxycycloocten-1-yl)oxysilane
Modify Date: 2025-10-07 09:10:05
trimethyl-(2-trimethylsilyloxycycloocten-1-yl)oxysilane structure
|
Common Name | trimethyl-(2-trimethylsilyloxycycloocten-1-yl)oxysilane | ||
|---|---|---|---|---|
| CAS Number | 78743-54-1 | Molecular Weight | 286.55800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H30O2Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-(2-trimethylsilyloxycycloocten-1-yl)oxysilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H30O2Si2 |
|---|---|
| Molecular Weight | 286.55800 |
| Exact Mass | 286.17800 |
| PSA | 18.46000 |
| LogP | 5.25520 |
| InChIKey | KPHYVCXSNQKZHW-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC1=C(O[Si](C)(C)C)CCCCCC1 |
|
~49%
trimethyl-(2-tr... CAS#:78743-54-1 |
| Literature: Brooks, Dee W.; Mazdiyasni, Hormoz; Sallay, Peter Journal of Organic Chemistry, 1985 , vol. 50, # 18 p. 3411 - 3414 |
|
~%
trimethyl-(2-tr... CAS#:78743-54-1 |
| Literature: Thompson, Glenn S.; Hirsch, Jerry A. Journal of Organic Chemistry, 1998 , vol. 63, # 4 p. 1098 - 1101 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| CTK2G4987 |
| 1,2-bis(trimethylsiloxy)cyclooctene |
| Silane,[1-cyclooctene-1,2-diylbis(oxy)]bis[trimethyl |