4-CHLORO-4'-ISO-PROPYLBENZOPHENONE structure
|
Common Name | 4-CHLORO-4'-ISO-PROPYLBENZOPHENONE | ||
|---|---|---|---|---|
| CAS Number | 78650-61-0 | Molecular Weight | 258.74300 | |
| Density | 1.127g/cm3 | Boiling Point | 370ºC at 760 mmHg | |
| Molecular Formula | C16H15ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.7ºC | |
| Name | (4-chlorophenyl)-(4-propan-2-ylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.127g/cm3 |
|---|---|
| Boiling Point | 370ºC at 760 mmHg |
| Molecular Formula | C16H15ClO |
| Molecular Weight | 258.74300 |
| Flash Point | 218.7ºC |
| Exact Mass | 258.08100 |
| PSA | 17.07000 |
| LogP | 4.69440 |
| Index of Refraction | 1.568 |
| InChIKey | SRABXVTYMMCJGW-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(C(=O)c2ccc(Cl)cc2)cc1 |
| HS Code | 2914700090 |
|---|
|
~71%
4-CHLORO-4'-ISO... CAS#:78650-61-0 |
| Literature: DOOSAN CORPORATION Patent: WO2008/91130 A1, 2008 ; Location in patent: Page/Page column 15-16 ; |
|
~71%
4-CHLORO-4'-ISO... CAS#:78650-61-0 |
| Literature: Hagberg, Erik C.; Goodridge, Brandon; Ugurlu, Ozan; Chumbley, Scott; Sheares, Valerie V. Macromolecules, 2004 , vol. 37, # 10 p. 3642 - 3650 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-Chloro-4'-iso-propylbenzophenone |