1H-Pyrazolo[3,4-d]pyrimidine,4-[(1-methyl-4-nitro-1H-imidazol-5-yl)thio]-1-(2,3,5-tri-O-acetyl-b-D-ribofuranosyl)- structure
|
Common Name | 1H-Pyrazolo[3,4-d]pyrimidine,4-[(1-methyl-4-nitro-1H-imidazol-5-yl)thio]-1-(2,3,5-tri-O-acetyl-b-D-ribofuranosyl)- | ||
|---|---|---|---|---|
| CAS Number | 78586-42-2 | Molecular Weight | 535.48700 | |
| Density | 1.7g/cm3 | Boiling Point | 728.8ºC at 760mmHg | |
| Molecular Formula | C20H21N7O9S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 394.6ºC | |
| Name | [3,4-diacetyloxy-5-[4-(3-methyl-5-nitroimidazol-4-yl)sulfanylpyrazolo[3,4-d]pyrimidin-1-yl]oxolan-2-yl]methyl acetate |
|---|
| Density | 1.7g/cm3 |
|---|---|
| Boiling Point | 728.8ºC at 760mmHg |
| Molecular Formula | C20H21N7O9S |
| Molecular Weight | 535.48700 |
| Flash Point | 394.6ºC |
| Exact Mass | 535.11200 |
| PSA | 220.67000 |
| LogP | 1.46630 |
| Index of Refraction | 1.729 |
| InChIKey | JPWHWZQDFFKRHO-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1OC(n2ncc3c(Sc4c([N+](=O)[O-])ncn4C)ncnc32)C(OC(C)=O)C1OC(C)=O |
|
~95%
1H-Pyrazolo[3,4... CAS#:78586-42-2 |
| Literature: Bhat; Montero; Panzica; Wotring; Townsend Journal of Medicinal Chemistry, 1981 , vol. 24, # 10 p. 1165 - 1172 |
|
~%
1H-Pyrazolo[3,4... CAS#:78586-42-2 |
| Literature: Bhat; Montero; Panzica; Wotring; Townsend Journal of Medicinal Chemistry, 1981 , vol. 24, # 10 p. 1165 - 1172 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |