ethyl N-(5-phenyl-1,4,5,6-tetrahydropyrimidin-2-yl)carbamate structure
|
Common Name | ethyl N-(5-phenyl-1,4,5,6-tetrahydropyrimidin-2-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 78533-62-7 | Molecular Weight | 247.29300 | |
| Density | 1.22g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl N-(5-phenyl-1,4,5,6-tetrahydropyrimidin-2-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.29300 |
| Exact Mass | 247.13200 |
| PSA | 66.21000 |
| LogP | 1.44430 |
| Index of Refraction | 1.594 |
| InChIKey | VGJBVNUSYWXMHD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC1=NCC(c2ccccc2)CN1 |
|
~%
ethyl N-(5-phen... CAS#:78533-62-7 |
| Literature: Weinhardt, Klaus; Wallach, Marshall B.; Marx, Michael Journal of Medicinal Chemistry, 1985 , vol. 28, # 6 p. 694 - 698 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-ethoxycarbonylamino-5-phenyl-1,4,5,6-tetrahydropyrimidine |