(1R,4aS,10aR)-1-isothiocyanato-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene
Modify Date: 2025-09-18 09:26:43
(1R,4aS,10aR)-1-isothiocyanato-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene structure
|
Common Name | (1R,4aS,10aR)-1-isothiocyanato-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene | ||
|---|---|---|---|---|
| CAS Number | 784213-51-0 | Molecular Weight | 313.50000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H27NS | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | (1R,4aS,10aR)-1-isothiocyanato-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H27NS |
|---|---|
| Molecular Weight | 313.50000 |
| Exact Mass | 313.18600 |
| PSA | 44.45000 |
| LogP | 5.67550 |
| InChIKey | LKPKIJGOKZTHAA-VAMGGRTRSA-N |
| SMILES | CC(C)c1ccc2c(c1)CCC1C(C)(N=C=S)CCCC21C |
| RIDADR | NONH for all modes of transport |
|---|
|
Degradingdehydroabietylisothiocyanate as a chiral derivatizing reagent for enantiomeric separations by capillary electrophoresis.
Electrophoresis 27 , 3428-3433, (2006) Abietic acid is a naturally occurring enantiomeric diterpenic acid. Its absolute optical purity and very stable stereochemistry structure makes it an excellent starting material for preparing chiral d... |
| Degradingdehydroabietyl isothiocyanate |
| DDHAIC |