3-nitro-4-(trifluoromethoxy)benzoic acid structure
|
Common Name | 3-nitro-4-(trifluoromethoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 784-77-0 | Molecular Weight | 223.580 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 258.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H5ClF3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110.0±27.3 °C | |
| Name | 3-Nitro-4-(trifluoromethoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 258.3±40.0 °C at 760 mmHg |
| Molecular Formula | C8H5ClF3NO |
| Molecular Weight | 223.580 |
| Flash Point | 110.0±27.3 °C |
| Exact Mass | 223.001175 |
| PSA | 92.35000 |
| LogP | 2.71 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.498 |
| InChIKey | GDBCQTKUSLDFRP-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(OC(F)(F)F)c([N+](=O)[O-])c1 |
| HS Code | 2918990090 |
|---|
|
~%
3-nitro-4-(trif... CAS#:784-77-0 |
| Literature: US6268387 B1, ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Chloro-3-(trifluoromethyl)benzamide |
| 4-Chloro-α,α,α-trifluoro-m-toluamide |
| ZVR DG CXFFF |
| Benzamide, 4-chloro-3-(trifluoromethyl)- |
| 3-Nitro-4-(trifluoromethoxy)benzoicAcid |
| 3-Nitro-4-trifluormethoxy-benzoesaeure |