1-(4-bromophenyl)-N-(4-nitrophenyl)methanimine structure
|
Common Name | 1-(4-bromophenyl)-N-(4-nitrophenyl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 78396-33-5 | Molecular Weight | 305.12700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-bromophenyl)-N-(4-nitrophenyl)methanimine |
|---|
| Molecular Formula | C13H9BrN2O2 |
|---|---|
| Molecular Weight | 305.12700 |
| Exact Mass | 303.98500 |
| PSA | 58.18000 |
| LogP | 4.63110 |
| InChIKey | NSGHUWBIFDOYAF-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N=Cc2ccc(Br)cc2)cc1 |
|
~%
1-(4-bromopheny... CAS#:78396-33-5 |
| Literature: Smith, Scott J.; Zimmer, Hans; Fluck, Ekkehard; Fischer, Peter Phosphorus and Sulfur and the Related Elements, 1988 , vol. 35, p. 105 - 120 |